6-Bromo-2-(2-chlorophenyl)quinoline-4-carboxylicacid

• CAS: 445289-24-7
• Catalog Number: ACM445289247
• Category: Bromine Series
• Molecular Weight: 362.61
• Molecular Formula: C₁₆H₉BrClNO₂
• Synonyms: 6-BROMO-2-(2-CHLOROPHENYL)QUINOLINE-4-CARBOXYLIC ACID

Custom Q&A

What is the molecular formula of the compound identified as PubChem CID 994004?

The molecular formula is C16H9BrClNO2.

What is the molecular weight of the compound?

The molecular weight is 362.60 g/mol.

What is the IUPAC name of the compound?

The IUPAC name is 6-bromo-2-(2-chlorophenyl)quinoline-4-carboxylic acid.

What is the Canonical SMILES representation of the compound?

The Canonical SMILES is C1=CC=C(C(=C1)C2=NC3=C(C=C(C=C3)Br)C(=C2)C(=O)O)Cl.

What is the InChIKey of the compound?

The InChIKey is MSJQBZXALAXXAN-UHFFFAOYSA-N.

What is the CAS number of the compound?

The CAS number is 445289-24-7.

How many hydrogen bond donor counts does the compound have?

The compound has 1 hydrogen bond donor count.

What is the XLogP3-AA value of the compound?

The XLogP3-AA value is 4.7.

What is the topological polar surface area of the compound?

The topological polar surface area is 50.2Ų.

Is the compound canonicalized?

Yes, the compound is canonicalized.