What is the molecular formula of 6-Bromo-2-(2,4-diethoxyphenyl)quinoline-4-carboxylic acid?
The molecular formula is C20H18BrNO4.
What is the PubChem CID of 6-Bromo-2-(2,4-diethoxyphenyl)quinoline-4-carboxylic acid?
The PubChem CID is 993996.
What is the IUPAC name of 6-Bromo-2-(2,4-diethoxyphenyl)quinoline-4-carboxylic acid?
The IUPAC name is 6-bromo-2-(2,4-diethoxyphenyl)quinoline-4-carboxylic acid.
What is the InChI of 6-Bromo-2-(2,4-diethoxyphenyl)quinoline-4-carboxylic acid?
The InChI is InChI=1S/C20H18BrNO4/c1-3-25-13-6-7-14(19(10-13)26-4-2)18-11-16(20(23)24)15-9-12(21)5-8-17(15)22-18/h5-11H,3-4H2,1-2H3,(H,23,24).
What is the InChIKey of 6-Bromo-2-(2,4-diethoxyphenyl)quinoline-4-carboxylic acid?
The InChIKey is KZYDJVKDQJNUED-UHFFFAOYSA-N.
What is the Canonical SMILES of 6-Bromo-2-(2,4-diethoxyphenyl)quinoline-4-carboxylic acid?
The Canonical SMILES is CCOC1=CC(=C(C=C1)C2=NC3=C(C=C(C=C3)Br)C(=C2)C(=O)OCC.
What is the molecular weight of 6-Bromo-2-(2,4-diethoxyphenyl)quinoline-4-carboxylic acid?
The molecular weight is 416.3 g/mol.
What is the CAS number of 6-Bromo-2-(2,4-diethoxyphenyl)quinoline-4-carboxylic acid?
The CAS number is 494860-96-7.
How many hydrogen bond donor counts does 6-Bromo-2-(2,4-diethoxyphenyl)quinoline-4-carboxylic acid have?
It has 1 hydrogen bond donor count.
How many rotatable bond counts does 6-Bromo-2-(2,4-diethoxyphenyl)quinoline-4-carboxylic acid have?
It has 6 rotatable bond counts.