CAS
1309982-25-9 Purity
---
1309982-25-9 Purity
---
Inquiry Basket
6-(2-Hydroxypropan-2-yl)pyridine-2-boronicacid
CAS
1309981-32-5
Catalog Number
ACM1309981325
Category
Boro-Amino Acids
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of the compound?
The molecular formula of the compound is C8H12BNO3.
What is the molecular weight of the compound?
The molecular weight of the compound is 181.00 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is [6-(2-hydroxypropan-2-yl)pyridin-2-yl]boronic acid.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C8H12BNO3/c1-8(2,11)6-4-3-5-7(10-6)9(12)13/h3-5,11-13H,1-2H3.
What is the InChIKey of the compound?
The InChIKey of the compound is OJKBHCOYAGROKV-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is B(C1=NC(=CC=C1)C(C)(C)O)(O)O.
What is the CAS number of the compound?
The CAS number of the compound is 1309981-32-5.
How many hydrogen bond donor counts does the compound have?
The compound has 3 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does the compound have?
The compound has 4 hydrogen bond acceptor counts.
How many rotatable bond counts does the compound have?
The compound has 2 rotatable bond counts.
Recommended Products
