5-(tert-Butylcarbamoyl)pyridine-3-boronicacidpinacolester

• CAS: 1218790-03-4
• Catalog Number: ACM1218790034-1
• Category: Boronic Esters

Custom Q&A

What is the molecular formula of the compound?

The molecular formula of the compound is C16H25BN2O3.

What is the PubChem CID of the compound?

The PubChem CID of the compound is 53217155.

When was the compound created?

The compound was created on June 21, 2011.

What is the IUPAC name of the compound?

The IUPAC name of the compound is N-tert-butyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carboxamide.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C16H25BN2O3/c1-14(2,3)19-13(20)11-8-12(10-18-9-11)17-21-15(4,5)16(6,7)22-17/h8-10H,1-7H3,(H,19,20).

What is the canonical SMILES of the compound?

The canonical SMILES of the compound is B1(OC(C(O1)(C)C)(C)C)C2=CC(=CN=C2)C(=O)NC(C)(C)C.

What is the molecular weight of the compound?

The molecular weight of the compound is 304.2 g/mol.

How many hydrogen bond donor counts does the compound have?

The compound has 1 hydrogen bond donor count.

How many hydrogen bond acceptor counts does the compound have?

The compound has 4 hydrogen bond acceptor counts.

Is the compound canonicalized?

Yes, the compound is canonicalized.