5-tert-Butyl-2-methoxybenzoic acid

• Catalog Number: ACMA00002240
• Category: Ethers
• Molecular Weight: 208.25
• Molecular Formula: C₁₂H₁₆O₃
• Hazard Statements: H302
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of 5-tert-butyl-2-methoxybenzoic acid?

The molecular formula of 5-tert-butyl-2-methoxybenzoic acid is C12H16O3.

What is the molecular weight of 5-tert-butyl-2-methoxybenzoic acid?

The molecular weight of 5-tert-butyl-2-methoxybenzoic acid is 208.25 g/mol.

What is the IUPAC name of 5-tert-butyl-2-methoxybenzoic acid?

The IUPAC name of 5-tert-butyl-2-methoxybenzoic acid is 5-tert-butyl-2-methoxybenzoic acid.

What is the InChI of 5-tert-butyl-2-methoxybenzoic acid?

The InChI of 5-tert-butyl-2-methoxybenzoic acid is InChI=1S/C12H16O3/c1-12(2,3)8-5-6-10(15-4)9(7-8)11(13)14/h5-7H,1-4H3,(H,13,14).

What is the InChIKey of 5-tert-butyl-2-methoxybenzoic acid?

The InChIKey of 5-tert-butyl-2-methoxybenzoic acid is ZXMIDYAIOHHLRW-UHFFFAOYSA-N.

What is the canonical SMILES of 5-tert-butyl-2-methoxybenzoic acid?

The canonical SMILES of 5-tert-butyl-2-methoxybenzoic acid is CC(C)(C)C1=CC(=C(C=C1)OC)C(=O)O.

What is the XLogP3 value of 5-tert-butyl-2-methoxybenzoic acid?

The XLogP3 value of 5-tert-butyl-2-methoxybenzoic acid is 3.3.

How many hydrogen bond donor counts does 5-tert-butyl-2-methoxybenzoic acid have?

5-tert-butyl-2-methoxybenzoic acid has 1 hydrogen bond donor count.

How many hydrogen bond acceptor counts does 5-tert-butyl-2-methoxybenzoic acid have?

5-tert-butyl-2-methoxybenzoic acid has 3 hydrogen bond acceptor counts.

How many rotatable bond counts does 5-tert-butyl-2-methoxybenzoic acid have?

5-tert-butyl-2-methoxybenzoic acid has 3 rotatable bond counts.