(5-Methyl-2-oxo-benzooxazol-3-yl)-acetic acid

• Catalog Number: ACMA00002081
• Category: Ethers
• Molecular Weight: 207.18
• Molecular Formula: C₁₀H₉BrO₄
• Hazard Statements: H302
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of (5-Methyl-2-oxo-benzooxazol-3-yl)-acetic acid?

The molecular formula is C10H9NO4.

What is the molecular weight of (5-Methyl-2-oxo-benzooxazol-3-yl)-acetic acid?

The molecular weight is 207.18 g/mol.

What is the IUPAC name of (5-Methyl-2-oxo-benzooxazol-3-yl)-acetic acid?

The IUPAC name is 2-(5-methyl-2-oxo-1,3-benzoxazol-3-yl)acetic acid.

What is the InChI code of (5-Methyl-2-oxo-benzooxazol-3-yl)-acetic acid?

The InChI code is InChI=1S/C10H9NO4/c1-6-2-3-8-7(4-6)11(5-9(12)13)10(14)15-8/h2-4H,5H2,1H3,(H,12,13).

What is the InChIKey of (5-Methyl-2-oxo-benzooxazol-3-yl)-acetic acid?

The InChIKey is JJMSSIVSZNVZFE-UHFFFAOYSA-N.

What is the canonical SMILES representation of (5-Methyl-2-oxo-benzooxazol-3-yl)-acetic acid?

The canonical SMILES representation is CC1=CC2=C(C=C1)OC(=O)N2CC(=O)O.

What is the CAS number of (5-Methyl-2-oxo-benzooxazol-3-yl)-acetic acid?

The CAS number is 767304-83-6.

How many hydrogen bond donor atoms are there in (5-Methyl-2-oxo-benzooxazol-3-yl)-acetic acid?

There is 1 hydrogen bond donor atom.

How many hydrogen bond acceptor atoms are there in (5-Methyl-2-oxo-benzooxazol-3-yl)-acetic acid?

There are 4 hydrogen bond acceptor atoms.