5-Methoxy-6-nitro-1H-indole

• CAS: 175913-29-8
• Catalog Number: ACM175913298
• Category: Other Products
• Molecular Weight: 192.17142
• Molecular Formula: C₉H₈N₂O₃
• Synonyms: 5-Methoxy-6-nitro-1H-indole

Custom Q&A

What is the molecular formula of 5-Methoxy-6-nitro-1H-indole?

The molecular formula of 5-Methoxy-6-nitro-1H-indole is C9H8N2O3.

What is the molecular weight of 5-Methoxy-6-nitro-1H-indole?

The molecular weight of 5-Methoxy-6-nitro-1H-indole is 192.17 g/mol.

What is the IUPAC name of 5-Methoxy-6-nitro-1H-indole?

The IUPAC name of 5-Methoxy-6-nitro-1H-indole is 5-methoxy-6-nitro-1H-indole.

What is the InChI of 5-Methoxy-6-nitro-1H-indole?

The InChI of 5-Methoxy-6-nitro-1H-indole is InChI=1S/C9H8N2O3/c1-14-9-4-6-2-3-10-7(6)5-8(9)11(12)13/h2-5,10H,1H3.

What is the InChIKey of 5-Methoxy-6-nitro-1H-indole?

The InChIKey of 5-Methoxy-6-nitro-1H-indole is WDXINEUUEKDULS-UHFFFAOYSA-N.

What is the canonical SMILES of 5-Methoxy-6-nitro-1H-indole?

The canonical SMILES of 5-Methoxy-6-nitro-1H-indole is COC1=C(C=C2C(=C1)C=CN2)[N+](=O)[O-].

How many hydrogen bond donor counts does 5-Methoxy-6-nitro-1H-indole have?

5-Methoxy-6-nitro-1H-indole has 1 hydrogen bond donor count.

How many hydrogen bond acceptor counts does 5-Methoxy-6-nitro-1H-indole have?

5-Methoxy-6-nitro-1H-indole has 3 hydrogen bond acceptor counts.

What is the topological polar surface area of 5-Methoxy-6-nitro-1H-indole?

The topological polar surface area of 5-Methoxy-6-nitro-1H-indole is 70.8 Ų.

Is 5-Methoxy-6-nitro-1H-indole a canonicalized compound?

Yes, 5-Methoxy-6-nitro-1H-indole is a canonicalized compound.