What is the molecular formula of 5-Fluoro-4-(trimethylsilyl)-1H-pyrrolo[2,3-b]pyridine?
The molecular formula is C10H13FN2Si.
What is the molecular weight of 5-Fluoro-4-(trimethylsilyl)-1H-pyrrolo[2,3-b]pyridine?
The molecular weight is 208.31 g/mol.
What is the IUPAC name of 5-Fluoro-4-(trimethylsilyl)-1H-pyrrolo[2,3-b]pyridine?
The IUPAC name is (5-fluoro-1H-pyrrolo[2,3-b]pyridin-4-yl)-trimethylsilane.
What is the InChI of 5-Fluoro-4-(trimethylsilyl)-1H-pyrrolo[2,3-b]pyridine?
The InChI is InChI=1S/C10H13FN2Si/c1-14(2,3)9-7-4-5-12-10(7)13-6-8(9)11/h4-6H,1-3H3,(H,12,13).
What is the InChIKey of 5-Fluoro-4-(trimethylsilyl)-1H-pyrrolo[2,3-b]pyridine?
The InChIKey is HTTKHFGDRKTCMS-UHFFFAOYSA-N.
What is the canonical SMILES of 5-Fluoro-4-(trimethylsilyl)-1H-pyrrolo[2,3-b]pyridine?
The canonical SMILES is C[Si](C)(C)C1=C2C=CNC2=NC=C1F.
What is the CAS number of 5-Fluoro-4-(trimethylsilyl)-1H-pyrrolo[2,3-b]pyridine?
The CAS number is 1228665-73-3.
How many hydrogen bond donor counts does 5-Fluoro-4-(trimethylsilyl)-1H-pyrrolo[2,3-b]pyridine have?
It has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does 5-Fluoro-4-(trimethylsilyl)-1H-pyrrolo[2,3-b]pyridine have?
It has 2 hydrogen bond acceptor counts.