5'-Fluoro-2'-hydroxyacetophenone

• CAS: 394-32-1
• Catalog Number: ACM394321
• Category: Aryl Fluorinated Building Blocks
• Molecular Weight: 154.14
• Hazard Statements: H315-H319-H335
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of 5'-Fluoro-2'-hydroxyacetophenone?

The molecular formula of 5'-Fluoro-2'-hydroxyacetophenone is C8H7FO2.

What is the molecular weight of 5'-Fluoro-2'-hydroxyacetophenone?

The molecular weight of 5'-Fluoro-2'-hydroxyacetophenone is 154.14 g/mol.

What is the IUPAC name of 5'-Fluoro-2'-hydroxyacetophenone?

The IUPAC name of 5'-Fluoro-2'-hydroxyacetophenone is 1-(5-fluoro-2-hydroxyphenyl)ethanone.

What is the InChI of 5'-Fluoro-2'-hydroxyacetophenone?

The InChI of 5'-Fluoro-2'-hydroxyacetophenone is InChI=1S/C8H7FO2/c1-5(10)7-4-6(9)2-3-8(7)11/h2-4,11H,1H3.

What is the InChIKey of 5'-Fluoro-2'-hydroxyacetophenone?

The InChIKey of 5'-Fluoro-2'-hydroxyacetophenone is KOFFXZYMDLWRHX-UHFFFAOYSA-N.

What is the CAS number of 5'-Fluoro-2'-hydroxyacetophenone?

The CAS number of 5'-Fluoro-2'-hydroxyacetophenone is 394-32-1.

How many hydrogen bond donor counts does 5'-Fluoro-2'-hydroxyacetophenone have?

5'-Fluoro-2'-hydroxyacetophenone has 1 hydrogen bond donor count.

How many hydrogen bond acceptor counts does 5'-Fluoro-2'-hydroxyacetophenone have?

5'-Fluoro-2'-hydroxyacetophenone has 3 hydrogen bond acceptor counts.

What is the topological polar surface area of 5'-Fluoro-2'-hydroxyacetophenone?

The topological polar surface area of 5'-Fluoro-2'-hydroxyacetophenone is 37.3 ?^2.

How many heavy atom counts does 5'-Fluoro-2'-hydroxyacetophenone have?

5'-Fluoro-2'-hydroxyacetophenone has 11 heavy atom counts.