CAS
1451393-24-0 Purity
---
1451393-24-0 Purity
---
Inquiry Basket
5-Carboxy-2-fluoropyridine-3-boronic acid
CAS
1451393-25-1
Catalog Number
ACM1451393251
Category
Boronic Acids
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 5-Carboxy-2-fluoropyridine-3-boronic acid?
The molecular formula is C6H5BFNO4.
What is the PubChem CID of 5-Carboxy-2-fluoropyridine-3-boronic acid?
The PubChem CID is 57497305.
What is the IUPAC name of 5-Carboxy-2-fluoropyridine-3-boronic acid?
The IUPAC name is 5-borono-6-fluoropyridine-3-carboxylic acid.
What is the InChI of 5-Carboxy-2-fluoropyridine-3-boronic acid?
The InChI is InChI=1S/C6H5BFNO4/c8-5-4(7(12)13)1-3(2-9-5)6(10)11/h1-2, 12-13H,(H,10,11).
What is the InChIKey of 5-Carboxy-2-fluoropyridine-3-boronic acid?
The InChIKey is BCLGBTWNYVSWCI-UHFFFAOYSA-N.
What is the canonical SMILES of 5-Carboxy-2-fluoropyridine-3-boronic acid?
The canonical SMILES is B(C1=CC(=CN=C1F)C(=O)O)(O)O.
What is the CAS number of 5-Carboxy-2-fluoropyridine-3-boronic acid?
The CAS number is 1451393-25-1.
What is the molecular weight of 5-Carboxy-2-fluoropyridine-3-boronic acid?
The molecular weight is 184.92 g/mol.
How many hydrogen bond donor counts does 5-Carboxy-2-fluoropyridine-3-boronic acid have?
It has 3 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 5-Carboxy-2-fluoropyridine-3-boronic acid have?
It has 6 hydrogen bond acceptor counts.
Recommended Products
![4-[(Dimethylamino)methyl]phenylboronic acid](https://resource.alfa-chemistry.com/structure/70799-12-1.gif)
