What is the molecular formula of 5-Bromo-2-methylbenzene-1-sulfonyl chloride?
The molecular formula is C7H6BrClO2S.
What is the molecular weight of 5-Bromo-2-methylbenzene-1-sulfonyl chloride?
The molecular weight is 269.54 g/mol.
What is the IUPAC name of 5-Bromo-2-methylbenzene-1-sulfonyl chloride?
The IUPAC name is 5-bromo-2-methylbenzenesulfonyl chloride.
What is the InChI of 5-Bromo-2-methylbenzene-1-sulfonyl chloride?
The InChI is InChI=1S/C7H6BrClO2S/c1-5-2-3-6(8)4-7(5)12(9,10)11/h2-4H,1H3.
What is the InChIKey of 5-Bromo-2-methylbenzene-1-sulfonyl chloride?
The InChIKey is OYSAFEFFWRNQJF-UHFFFAOYSA-N.
What is the canonical SMILES of 5-Bromo-2-methylbenzene-1-sulfonyl chloride?
The canonical SMILES is CC1=C(C=C(C=C1)Br)S(=O)(=O)Cl.
What is the CAS number of 5-Bromo-2-methylbenzene-1-sulfonyl chloride?
The CAS number is 69321-56-8.
What is the European Community (EC) Number of 5-Bromo-2-methylbenzene-1-sulfonyl chloride?
The European Community (EC) Number is 816-696-1.
What is the DSSTox Substance ID of 5-Bromo-2-methylbenzene-1-sulfonyl chloride?
The DSSTox Substance ID is DTXSID40407019.
Is 5-Bromo-2-methylbenzene-1-sulfonyl chloride a canonicalized compound?
Yes, it is a canonicalized compound.