CAS
83622-42-8 Purity
---
83622-42-8 Purity
---
Shopping basket
5-Bromo-2-methoxypyridine-3-boronic acid
CAS
850864-59-4
Catalog Number
ACM850864594
Category
Boronic Acids
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 5-Bromo-2-methoxypyridine-3-boronic acid?
The molecular formula is C6H7BBrNO3.
What is the molecular weight of 5-Bromo-2-methoxypyridine-3-boronic acid?
The molecular weight is 231.84 g/mol.
What is the IUPAC name of 5-Bromo-2-methoxypyridine-3-boronic acid?
The IUPAC name is (5-bromo-2-methoxypyridin-3-yl)boronic acid.
What is the InChI of 5-Bromo-2-methoxypyridine-3-boronic acid?
The InChI is InChI=1S/C6H7BBrNO3/c1-12-6-5(7(10)11)2-4(8)3-9-6/h2-3,10-11H,1H3.
What is the InChIKey of 5-Bromo-2-methoxypyridine-3-boronic acid?
The InChIKey is KIMPFSRSIJTVLK-UHFFFAOYSA-N.
What is the canonical SMILES of 5-Bromo-2-methoxypyridine-3-boronic acid?
The canonical SMILES is B(C1=CC(=CN=C1OC)Br)(O)O.
What is the CAS number of 5-Bromo-2-methoxypyridine-3-boronic acid?
The CAS number is 850864-59-4.
How many hydrogen bond donor counts are there in 5-Bromo-2-methoxypyridine-3-boronic acid?
There are 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts are there in 5-Bromo-2-methoxypyridine-3-boronic acid?
There are 4 hydrogen bond acceptor counts.
What is the topological polar surface area of 5-Bromo-2-methoxypyridine-3-boronic acid?
The topological polar surface area is 62.6Ų.
Recommended Products
