5-Bromo-2-fluoropyrimidine

• CAS: 62802-38-4
• Catalog Number: ACM62802384
• Category: Bromine Series
• Molecular Weight: 176.97
• Molecular Formula: C₄H₂N₂BrF

Custom Q&A

What is the molecular formula of 5-Bromo-2-fluoropyrimidine?

The molecular formula of 5-Bromo-2-fluoropyrimidine is C4H2BrFN2.

What is the molecular weight of 5-Bromo-2-fluoropyrimidine?

The molecular weight of 5-Bromo-2-fluoropyrimidine is 176.97 g/mol.

What is the IUPAC name of 5-Bromo-2-fluoropyrimidine?

The IUPAC name of 5-Bromo-2-fluoropyrimidine is 5-bromo-2-fluoropyrimidine.

What is the InChI of 5-Bromo-2-fluoropyrimidine?

The InChI of 5-Bromo-2-fluoropyrimidine is InChI=1S/C4H2BrFN2/c5-3-1-7-4(6)8-2-3/h1-2H.

What is the InChIKey of 5-Bromo-2-fluoropyrimidine?

The InChIKey of 5-Bromo-2-fluoropyrimidine is CTWZYPZCDJKBRS-UHFFFAOYSA-N.

What is the canonical SMILES of 5-Bromo-2-fluoropyrimidine?

The canonical SMILES of 5-Bromo-2-fluoropyrimidine is C1=C(C=NC(=N1)F)Br.

What is the CAS number of 5-Bromo-2-fluoropyrimidine?

The CAS number of 5-Bromo-2-fluoropyrimidine is 62802-38-4.

What is the EC number of 5-Bromo-2-fluoropyrimidine?

The EC number of 5-Bromo-2-fluoropyrimidine is 672-908-0.

What is the DSSTox Substance ID of 5-Bromo-2-fluoropyrimidine?

The DSSTox Substance ID of 5-Bromo-2-fluoropyrimidine is DTXSID00344956.

Is 5-Bromo-2-fluoropyrimidine a canonicalized compound?

Yes, 5-Bromo-2-fluoropyrimidine is a canonicalized compound.