CAS
3034-22-8 Purity
---
3034-22-8 Purity
---
Inquiry Basket
5-Bromo-2-cyclopropylpyrimidine
CAS
304902-96-3
Catalog Number
ACM304902963
Category
Bromine Series
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 5-Bromo-2-cyclopropylpyrimidine?
The molecular formula of 5-Bromo-2-cyclopropylpyrimidine is C7H7BrN2.
What is the molecular weight of 5-Bromo-2-cyclopropylpyrimidine?
The molecular weight of 5-Bromo-2-cyclopropylpyrimidine is 199.05 g/mol.
What is the IUPAC name of 5-Bromo-2-cyclopropylpyrimidine?
The IUPAC name of 5-Bromo-2-cyclopropylpyrimidine is 5-bromo-2-cyclopropylpyrimidine.
What is the InChI of 5-Bromo-2-cyclopropylpyrimidine?
The InChI of 5-Bromo-2-cyclopropylpyrimidine is InChI=1S/C7H7BrN2/c8-6-3-9-7(10-4-6)5-1-2-5/h3-5H,1-2H2.
What is the InChIKey of 5-Bromo-2-cyclopropylpyrimidine?
The InChIKey of 5-Bromo-2-cyclopropylpyrimidine is ANURJXNEVQWODA-UHFFFAOYSA-N.
What is the canonical SMILES of 5-Bromo-2-cyclopropylpyrimidine?
The canonical SMILES of 5-Bromo-2-cyclopropylpyrimidine is C1CC1C2=NC=C(C=N2)Br.
What is the CAS number of 5-Bromo-2-cyclopropylpyrimidine?
The CAS number of 5-Bromo-2-cyclopropylpyrimidine is 304902-96-3.
What is the XLogP3-AA value of 5-Bromo-2-cyclopropylpyrimidine?
The XLogP3-AA value of 5-Bromo-2-cyclopropylpyrimidine is 1.5.
How many hydrogen bond donor counts does 5-Bromo-2-cyclopropylpyrimidine have?
5-Bromo-2-cyclopropylpyrimidine has 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 5-Bromo-2-cyclopropylpyrimidine have?
5-Bromo-2-cyclopropylpyrimidine has 2 hydrogen bond acceptor counts.
Recommended Products
