5-Bromo-2-chloro-4-fluorotoluene

• Catalog Number: ACMA00001576
• Category: Aryl
• Molecular Weight: 223.47
• Molecular Formula: C₇H₃F₄I
• Hazard Statements: H315-H319-H335
• RIDADR: UN 2811 6.1 / PGIII
• Symbol: GHS07

Custom Q&A

What is the molecular formula of 5-Bromo-2-chloro-4-fluorotoluene?

The molecular formula of 5-Bromo-2-chloro-4-fluorotoluene is C7H5BrClF.

What is the molecular weight of 5-Bromo-2-chloro-4-fluorotoluene?

The molecular weight of 5-Bromo-2-chloro-4-fluorotoluene is 223.47 g/mol.

What is the IUPAC name of 5-Bromo-2-chloro-4-fluorotoluene?

The IUPAC name of 5-Bromo-2-chloro-4-fluorotoluene is 1-bromo-4-chloro-2-fluoro-5-methylbenzene.

What is the InChI of 5-Bromo-2-chloro-4-fluorotoluene?

The InChI of 5-Bromo-2-chloro-4-fluorotoluene is InChI=1S/C7H5BrClF/c1-4-2-5(8)7(10)3-6(4)9/h2-3H,1H3.

What is the InChIKey of 5-Bromo-2-chloro-4-fluorotoluene?

The InChIKey of 5-Bromo-2-chloro-4-fluorotoluene is FHMGARFZRFRQNI-UHFFFAOYSA-N.

What is the canonical SMILES of 5-Bromo-2-chloro-4-fluorotoluene?

The canonical SMILES of 5-Bromo-2-chloro-4-fluorotoluene is CC1=CC(=C(C=C1Cl)F)Br.

What is the CAS number of 5-Bromo-2-chloro-4-fluorotoluene?

The CAS number of 5-Bromo-2-chloro-4-fluorotoluene is 200190-87-0.

What is the XLogP3-AA value of 5-Bromo-2-chloro-4-fluorotoluene?

The XLogP3-AA value of 5-Bromo-2-chloro-4-fluorotoluene is 3.7.

How many hydrogen bond donor count does 5-Bromo-2-chloro-4-fluorotoluene have?

5-Bromo-2-chloro-4-fluorotoluene has 0 hydrogen bond donor count.

How many rotatable bond count does 5-Bromo-2-chloro-4-fluorotoluene have?

5-Bromo-2-chloro-4-fluorotoluene has 0 rotatable bond count.