5,6-Dihydroxy-1H-indole-2-carboxylic acid

CAS

4790-08-3

Catalog Number

ACM4790083

Category

Other Products

Molecular Weight

Molecular Formula

C₉H₇NO₄

MSDS COA Spec Sheet

If you have any other questions or need other size, please get a quote.

Specification

Synonyms

5,6-dihydroxy-1H-indole-2-carboxylic acid;5,6-Dihydroxyindole-2-carboxylic acid;5,6-dihydroxy-2-indolylcarboxylic acid;1H-Indole-2-carboxylicacid, 5,6-dihydroxy-;2-Carboxy-5,6-dihydroxyindole;5,6-Dihydroxy-2-carboxyindole

What is the molecular formula of 5,6-Dihydroxy-1H-indole-2-carboxylic acid?

The molecular formula of 5,6-Dihydroxy-1H-indole-2-carboxylic acid is C9H7NO4.

When was 5,6-Dihydroxy-1H-indole-2-carboxylic acid created according to the reference?

5,6-Dihydroxy-1H-indole-2-carboxylic acid was created on 2004-09-16.

What is the computed molecular weight of 5,6-Dihydroxy-1H-indole-2-carboxylic acid?

The computed molecular weight of 5,6-Dihydroxy-1H-indole-2-carboxylic acid is 193.16 g/mol.

What is the InChIKey for 5,6-Dihydroxy-1H-indole-2-carboxylic acid?

The InChIKey for 5,6-Dihydroxy-1H-indole-2-carboxylic acid is YFTGOBNOJKXZJC-UHFFFAOYSA-N.

What is the Canonical SMILES representation of 5,6-Dihydroxy-1H-indole-2-carboxylic acid?

The Canonical SMILES representation of 5,6-Dihydroxy-1H-indole-2-carboxylic acid is C1=C2C=C(NC2=CC(=C1O)O)C(=O)O.

How many hydrogen bond donor counts does 5,6-Dihydroxy-1H-indole-2-carboxylic acid have?

5,6-Dihydroxy-1H-indole-2-carboxylic acid has 4 hydrogen bond donor counts.

What is the topological polar surface area of 5,6-Dihydroxy-1H-indole-2-carboxylic acid?

The topological polar surface area of 5,6-Dihydroxy-1H-indole-2-carboxylic acid is 93.6 Å².

Does 5,6-Dihydroxy-1H-indole-2-carboxylic acid have any defined atom stereocenter counts?

No, 5,6-Dihydroxy-1H-indole-2-carboxylic acid does not have any defined atom stereocenter counts.

What is the UNII identifier for 5,6-Dihydroxy-1H-indole-2-carboxylic acid?

The UNII identifier for 5,6-Dihydroxy-1H-indole-2-carboxylic acid is S6M6LZR326.

What is the ChEMBL ID for 5,6-Dihydroxy-1H-indole-2-carboxylic acid?

The ChEMBL ID for 5,6-Dihydroxy-1H-indole-2-carboxylic acid is CHEMBL267855.