What is the molecular formula of 4-(Trifluoromethoxy)-1H-indole-2-carboxylic acid?
The molecular formula is C10H6F3NO3.
What is the molecular weight of 4-(Trifluoromethoxy)-1H-indole-2-carboxylic acid?
The molecular weight is 245.15 g/mol.
What is the IUPAC name of 4-(Trifluoromethoxy)-1H-indole-2-carboxylic acid?
The IUPAC name is 4-(trifluoromethoxy)-1H-indole-2-carboxylic acid.
What is the InChI key of 4-(Trifluoromethoxy)-1H-indole-2-carboxylic acid?
The InChI key is NXLKLROWBALFPC-UHFFFAOYSA-N.
What is the Canonical SMILES of 4-(Trifluoromethoxy)-1H-indole-2-carboxylic acid?
The Canonical SMILES is C1=CC2=C(C=C(N2)C(=O)O)C(=C1)OC(F)(F)F.
How many hydrogen bond donor counts are in 4-(Trifluoromethoxy)-1H-indole-2-carboxylic acid?
There are 2 hydrogen bond donor counts.
What is the topological polar surface area of 4-(Trifluoromethoxy)-1H-indole-2-carboxylic acid?
The topological polar surface area is 62.3 Ų.
How many rotatable bond counts are in 4-(Trifluoromethoxy)-1H-indole-2-carboxylic acid?
There are 2 rotatable bond counts.
Is 4-(Trifluoromethoxy)-1H-indole-2-carboxylic acid a canonicalized compound?
Yes, it is a canonicalized compound.
When was 4-(Trifluoromethoxy)-1H-indole-2-carboxylic acid created and last modified?
It was created on 2007-11-13 and last modified on 2023-12-30.