What is the molecular formula of 4-(tert-Butylaminocarbonyl)phenylboronic acid?
The molecular formula is C11H16BNO3.
What is the PubChem CID of 4-(tert-Butylaminocarbonyl)phenylboronic acid?
The PubChem CID is 2773312.
What is the molecular weight of 4-(tert-Butylaminocarbonyl)phenylboronic acid?
The molecular weight is 221.06 g/mol.
What is the IUPAC name of 4-(tert-Butylaminocarbonyl)phenylboronic acid?
The IUPAC name is [4-(tert-butylcarbamoyl)phenyl]boronic acid.
What is the InChI of 4-(tert-Butylaminocarbonyl)phenylboronic acid?
The InChI is InChI=1S/C11H16BNO3/c1-11(2,3)13-10(14)8-4-6-9(7-5-8)12(15)16/h4-7,15-16H,1-3H3,(H,13,14).
What is the InChIKey of 4-(tert-Butylaminocarbonyl)phenylboronic acid?
The InChIKey is JAIIZPWLCVMPFA-UHFFFAOYSA-N.
What is the canonical SMILES of 4-(tert-Butylaminocarbonyl)phenylboronic acid?
The canonical SMILES is B(C1=CC=C(C=C1)C(=O)NC(C)(C)C)(O)O.
What is the CAS number of 4-(tert-Butylaminocarbonyl)phenylboronic acid?
The CAS number is 850568-14-8.
How many hydrogen bond donor counts does 4-(tert-Butylaminocarbonyl)phenylboronic acid have?
It has 3 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 4-(tert-Butylaminocarbonyl)phenylboronic acid have?
It has 3 hydrogen bond acceptor counts.