4-Methyl-4H-furo[3,2-b]pyrrole-5-carboxylic acid

• Catalog Number: ACMA00002762
• Category: Ethers
• Molecular Weight: 165.15
• Molecular Formula: C₈H₇ClO₃
• Hazard Statements: H302
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of 4-Methyl-4H-furo[3,2-b]pyrrole-5-carboxylic acid?

The molecular formula of 4-Methyl-4H-furo[3,2-b]pyrrole-5-carboxylic acid is C8H7NO3.

What is the molecular weight of 4-Methyl-4H-furo[3,2-b]pyrrole-5-carboxylic acid?

The molecular weight of 4-Methyl-4H-furo[3,2-b]pyrrole-5-carboxylic acid is 165.15 g/mol.

What is the IUPAC name of 4-Methyl-4H-furo[3,2-b]pyrrole-5-carboxylic acid?

The IUPAC name of 4-Methyl-4H-furo[3,2-b]pyrrole-5-carboxylic acid is 4-methylfuro[3,2-b]pyrrole-5-carboxylic acid.

What is the InChI key of 4-Methyl-4H-furo[3,2-b]pyrrole-5-carboxylic acid?

The InChI key of 4-Methyl-4H-furo[3,2-b]pyrrole-5-carboxylic acid is ITEWRYWRNQCNHT-UHFFFAOYSA-N.

What is the canonical SMILES of 4-Methyl-4H-furo[3,2-b]pyrrole-5-carboxylic acid?

The canonical SMILES of 4-Methyl-4H-furo[3,2-b]pyrrole-5-carboxylic acid is CN1C2=C(C=C1C(=O)O)OC=C2.

What is the CAS number of 4-Methyl-4H-furo[3,2-b]pyrrole-5-carboxylic acid?

The CAS number of 4-Methyl-4H-furo[3,2-b]pyrrole-5-carboxylic acid is 117613-30-6.

How many hydrogen bond donor counts does 4-Methyl-4H-furo[3,2-b]pyrrole-5-carboxylic acid have?

4-Methyl-4H-furo[3,2-b]pyrrole-5-carboxylic acid has 1 hydrogen bond donor count.

How many hydrogen bond acceptor counts does 4-Methyl-4H-furo[3,2-b]pyrrole-5-carboxylic acid have?

4-Methyl-4H-furo[3,2-b]pyrrole-5-carboxylic acid has 3 hydrogen bond acceptor counts.

How many rotatable bond counts does 4-Methyl-4H-furo[3,2-b]pyrrole-5-carboxylic acid have?

4-Methyl-4H-furo[3,2-b]pyrrole-5-carboxylic acid has 1 rotatable bond count.