119478-56-7 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C13H19BO3.
The molecular weight of the compound is 234.10 g/mol.
The IUPAC name of the compound is 4-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol.
The InChI of the compound is InChI=1S/C13H19BO3/c1-9-6-7-10(15)8-11(9)14-16-12(2,3)13(4,5)17-14/h6-8,15H,1-5H3.
The InChIKey of the compound is VYEXCFTWIDNOKN-UHFFFAOYSA-N.
The canonical SMILES of the compound is B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)O)C.
The CAS number of the compound is 1196985-65-5.
The compound has 1 hydrogen bond donor count.
The compound has 3 hydrogen bond acceptor counts.
The compound has 1 rotatable bond count.