4-Methoxynaphthalene-1-boronic acid

• CAS: 219834-95-4
• Catalog Number: ACM219834954
• Category: Boronic Acids
• Molecular Weight: 202.01
• Molecular Formula: C₁₁H₁₁BO₃

Custom Q&A

What is the molecular formula of 4-Methoxynaphthalene-1-boronic acid?

The molecular formula of 4-Methoxynaphthalene-1-boronic acid is C11H11BO3.

What is the molecular weight of 4-Methoxynaphthalene-1-boronic acid?

The molecular weight of 4-Methoxynaphthalene-1-boronic acid is 202.02 g/mol.

What is the IUPAC name of 4-Methoxynaphthalene-1-boronic acid?

The IUPAC name of 4-Methoxynaphthalene-1-boronic acid is "(4-methoxynaphthalen-1-yl)boronic acid".

What is the InChI of 4-Methoxynaphthalene-1-boronic acid?

The InChI of 4-Methoxynaphthalene-1-boronic acid is "InChI=1S/C11H11BO3/c1-15-11-7-6-10(12(13)14)8-4-2-3-5-9(8)11/h2-7,13-14H,1H3".

What is the InChIKey of 4-Methoxynaphthalene-1-boronic acid?

The InChIKey of 4-Methoxynaphthalene-1-boronic acid is "UNEURVGVRYJOMG-UHFFFAOYSA-N".

What is the canonical SMILES of 4-Methoxynaphthalene-1-boronic acid?

The canonical SMILES of 4-Methoxynaphthalene-1-boronic acid is "B(C1=CC=C(C2=CC=CC=C12)OC)(O)O".

What is the CAS number of 4-Methoxynaphthalene-1-boronic acid?

The CAS number of 4-Methoxynaphthalene-1-boronic acid is 219834-95-4.

How many hydrogen bond donor counts does 4-Methoxynaphthalene-1-boronic acid have?

4-Methoxynaphthalene-1-boronic acid has 2 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does 4-Methoxynaphthalene-1-boronic acid have?

4-Methoxynaphthalene-1-boronic acid has 3 hydrogen bond acceptor counts.