4-(Methoxymethyl)benzoic acid

• Catalog Number: ACMA00002890
• Category: Ethers
• Molecular Weight: 166.17
• Molecular Formula: C₉H₁₀O₃
• Hazard Statements: H319
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of 4-(Methoxymethyl)benzoic acid?

The molecular formula of 4-(Methoxymethyl)benzoic acid is C9H10O3.

What is the molecular weight of 4-(Methoxymethyl)benzoic acid?

The molecular weight of 4-(Methoxymethyl)benzoic acid is 166.17 g/mol.

What is the IUPAC name of 4-(Methoxymethyl)benzoic acid?

The IUPAC name of 4-(Methoxymethyl)benzoic acid is 4-(methoxymethyl)benzoic acid.

What is the InChI of 4-(Methoxymethyl)benzoic acid?

The InChI of 4-(Methoxymethyl)benzoic acid is InChI=1S/C9H10O3/c1-12-6-7-2-4-8(5-3-7)9(10)11/h2-5H,6H2,1H3,(H,10,11).

What is the InChIKey of 4-(Methoxymethyl)benzoic acid?

The InChIKey of 4-(Methoxymethyl)benzoic acid is OORFINRYBCDBEN-UHFFFAOYSA-N.

What is the Canonical SMILES of 4-(Methoxymethyl)benzoic acid?

The Canonical SMILES of 4-(Methoxymethyl)benzoic acid is COCC1=CC=C(C=C1)C(=O)O.

How many hydrogen bond donor counts does 4-(Methoxymethyl)benzoic acid have?

4-(Methoxymethyl)benzoic acid has one hydrogen bond donor count.

What is the topological polar surface area of 4-(Methoxymethyl)benzoic acid?

The topological polar surface area of 4-(Methoxymethyl)benzoic acid is 46.5Ų.

Is 4-(Methoxymethyl)benzoic acid canonicalized?

Yes, 4-(Methoxymethyl)benzoic acid is canonicalized.

What is the formal charge of 4-(Methoxymethyl)benzoic acid?

The formal charge of 4-(Methoxymethyl)benzoic acid is 0.