4-(Methoxymethyl)aniline

• Catalog Number: ACMA00002711
• Category: Ethers
• Molecular Weight: 137.18
• Hazard Statements: H226-H302-H315-H361-H412
• RIDADR: UN 2811 6.1 / PGIII
• Symbol: GHS02

Custom Q&A

What is the molecular formula of 4-(Methoxymethyl)aniline?

The molecular formula is C8H11NO.

What is the molecular weight of 4-(Methoxymethyl)aniline?

The molecular weight is 137.18 g/mol.

What is the IUPAC name of 4-(Methoxymethyl)aniline?

The IUPAC name is 4-(methoxymethyl)aniline.

What is the InChI code of 4-(Methoxymethyl)aniline?

The InChI code is InChI=1S/C8H11NO/c1-10-6-7-2-4-8(9)5-3-7/h2-5H,6,9H2,1H3.

What is the InChIKey of 4-(Methoxymethyl)aniline?

The InChIKey is URSADVDNUKPSIK-UHFFFAOYSA-N.

What is the canonical SMILES of 4-(Methoxymethyl)aniline?

The canonical SMILES is COCC1=CC=C(C=C1)N.

What is the CAS number of 4-(Methoxymethyl)aniline?

The CAS number is 80936-82-9.

What is the XLogP3 value of 4-(Methoxymethyl)aniline?

The XLogP3 value is 0.3.

How many hydrogen bond donor counts does 4-(Methoxymethyl)aniline have?

It has 1 hydrogen bond donor count.

How many hydrogen bond acceptor counts does 4-(Methoxymethyl)aniline have?

It has 2 hydrogen bond acceptor counts.