4-(Methoxymethoxy)-2,6-dimethylphenylboronic acid

• CAS: 1000414-17-4
• Catalog Number: ACM1000414174
• Category: Boronic Acids

Custom Q&A

What is the molecular formula of 4-(Methoxymethoxy)-2,6-dimethylphenylboronic acid?

The molecular formula is C10H15BO4.

When was 4-(Methoxymethoxy)-2,6-dimethylphenylboronic acid created and modified?

It was created on 2012-08-08 and modified on 2023-12-02.

What is the IUPAC Name of 4-(Methoxymethoxy)-2,6-dimethylphenylboronic acid?

The IUPAC Name is [4-(methoxymethoxy)-2,6-dimethylphenyl]boronic acid.

What is the Canonical SMILES of 4-(Methoxymethoxy)-2,6-dimethylphenylboronic acid?

The Canonical SMILES is B(C1=C(C=C(C=C1C)OCOC)C)(O)O.

How many heavy atoms are there in the compound?

There are 15 heavy atoms.

What is the exact mass of 4-(Methoxymethoxy)-2,6-dimethylphenylboronic acid?

The exact mass is 210.1063391 g/mol.

How many hydrogen bond donor counts are there in the compound?

There are 2 hydrogen bond donor counts.

Is 4-(Methoxymethoxy)-2,6-dimethylphenylboronic acid a canonicalized compound?

Yes, it is a canonicalized compound.

What is the topological polar surface area of the compound?

The topological polar surface area is 58.9Ų.

How many rotatable bond counts are there in the compound?

There are 4 rotatable bond counts.