What is the molecular formula of 4-Methoxycinnamic acid 2-ethylhexyl ester?
The molecular formula is C18H26O3.
What is the molecular weight of 4-Methoxycinnamic acid 2-ethylhexyl ester?
The molecular weight is 290.4 g/mol.
Is 4-Methoxycinnamic acid 2-ethylhexyl ester a colorless or pale yellow viscous liquid?
Yes, it is described as a colorless to pale yellow viscous liquid.
What is the IUPAC name of 4-Methoxycinnamic acid 2-ethylhexyl ester?
The IUPAC name is 2-ethylhexyl (E)-3-(4-methoxyphenyl)prop-2-enoate.
What is the InChI of 4-Methoxycinnamic acid 2-ethylhexyl ester?
The InChI is InChI=1S/C18H26O3/c1-4-6-7-15(5-2)14-21-18(19)13-10-16-8-11-17(20-3)12-9-16/h8-13,15H,4-7,14H2,1-3H3/b13-10+.
How many hydrogen bond donor counts does 4-Methoxycinnamic acid 2-ethylhexyl ester have?
It has 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 4-Methoxycinnamic acid 2-ethylhexyl ester have?
It has 3 hydrogen bond acceptor counts.
How many rotatable bond counts does 4-Methoxycinnamic acid 2-ethylhexyl ester have?
It has 10 rotatable bond counts.
What is the exact mass of 4-Methoxycinnamic acid 2-ethylhexyl ester?
The exact mass is 290.18819469 g/mol.
What is the CAS number of 4-Methoxycinnamic acid 2-ethylhexyl ester?
The CAS number is 5466-77-3.