4-Methoxy-3-methoxymethyl-benzaldehyde

• Catalog Number: ACMA00002033
• Category: Ethers
• Molecular Weight: 180.20
• Molecular Formula: C₁₀H₁₂O₃
• Hazard Statements: H317
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of 4-Methoxy-3-methoxymethyl-benzaldehyde?

The molecular formula is C10H12O3.

What is the molecular weight of 4-Methoxy-3-methoxymethyl-benzaldehyde?

The molecular weight is 180.20 g/mol.

What is the IUPAC name of 4-Methoxy-3-methoxymethyl-benzaldehyde?

The IUPAC name is 4-methoxy-3-(methoxymethyl)benzaldehyde.

What is the InChI of 4-Methoxy-3-methoxymethyl-benzaldehyde?

The InChI is InChI=1S/C10H12O3/c1-12-7-9-5-8(6-11)3-4-10(9)13-2/h3-6H,7H2,1-2H3.

What is the InChIKey of 4-Methoxy-3-methoxymethyl-benzaldehyde?

The InChIKey is SSPSDHKFVVPEOE-UHFFFAOYSA-N.

What is the canonical SMILES of 4-Methoxy-3-methoxymethyl-benzaldehyde?

The canonical SMILES is COCC1=C(C=CC(=C1)C=O)OC.

What is the CAS number of 4-Methoxy-3-methoxymethyl-benzaldehyde?

The CAS number is 76646-41-8.

What is the XLogP3 value of 4-Methoxy-3-methoxymethyl-benzaldehyde?

The XLogP3 value is 1.5.

How many hydrogen bond donor counts does 4-Methoxy-3-methoxymethyl-benzaldehyde have?

4-Methoxy-3-methoxymethyl-benzaldehyde has 0 hydrogen bond donor counts.

How many rotatable bond counts does 4-Methoxy-3-methoxymethyl-benzaldehyde have?

4-Methoxy-3-methoxymethyl-benzaldehyde has 4 rotatable bond counts.