4-Isopropoxycarbonylphenylboronic acid

• CAS: 342002-82-8
• Catalog Number: ACM342002828
• Category: Boronic Acids
• Molecular Weight: 208.02
• Molecular Formula: C₁₀H₁₃BO₄

Custom Q&A

What is the PubChem CID for 4-Isopropoxycarbonylphenylboronic acid?

The PubChem CID for 4-Isopropoxycarbonylphenylboronic acid is 2734703.

What is the molecular formula of 4-Isopropoxycarbonylphenylboronic acid?

The molecular formula of 4-Isopropoxycarbonylphenylboronic acid is C10H13BO4.

What is the molecular weight of 4-Isopropoxycarbonylphenylboronic acid?

The molecular weight of 4-Isopropoxycarbonylphenylboronic acid is 208.02 g/mol.

When was 4-Isopropoxycarbonylphenylboronic acid created?

4-Isopropoxycarbonylphenylboronic acid was created on July 19, 2005.

What is the IUPAC name of 4-Isopropoxycarbonylphenylboronic acid?

The IUPAC name of 4-Isopropoxycarbonylphenylboronic acid is (4-propan-2-yloxycarbonylphenyl)boronic acid.

What is the InChI of 4-Isopropoxycarbonylphenylboronic acid?

The InChI of 4-Isopropoxycarbonylphenylboronic acid is InChI=1S/C10H13BO4/c1-7(2)15-10(12)8-3-5-9(6-4-8)11(13)14/h3-7,13-14H,1-2H3.

What is the InChIKey of 4-Isopropoxycarbonylphenylboronic acid?

The InChIKey of 4-Isopropoxycarbonylphenylboronic acid is NIQHFKWRHJZMQU-UHFFFAOYSA-N.

What is the Canonical SMILES of 4-Isopropoxycarbonylphenylboronic acid?

The Canonical SMILES of 4-Isopropoxycarbonylphenylboronic acid is B(C1=CC=C(C=C1)C(=O)OC(C)C)(O)O.

What is the CAS number of 4-Isopropoxycarbonylphenylboronic acid?

The CAS number of 4-Isopropoxycarbonylphenylboronic acid is 342002-82-8.

What is the hydrogen bond donor count of 4-Isopropoxycarbonylphenylboronic acid?

The hydrogen bond donor count of 4-Isopropoxycarbonylphenylboronic acid is 2.