4-Hydroxy-2-methylbenzaldehyde

• Catalog Number: ACMA00003051
• Category: Phenols
• Molecular Weight: 136.15
• Molecular Formula: C₈H₇BrO₃
• Hazard Statements: H315-H319-H335
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the IUPAC name of the compound?

The IUPAC name of the compound is 4-hydroxy-2-methylbenzaldehyde.

What is the molecular weight of the compound?

The molecular weight of the compound is 136.15 g/mol.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C8H8O2/c1-6-4-8(10)3-2-7(6)5-9/h2-5,10H,1H3.

What is the CAS number of the compound?

The CAS number of the compound is 41438-18-0.

How many hydrogen bond donor counts does the compound have?

The compound has 1 hydrogen bond donor count.

How many hydrogen bond acceptor counts does the compound have?

The compound has 2 hydrogen bond acceptor counts.

What is the topological polar surface area of the compound?

The topological polar surface area of the compound is 37.3Ų.

How many heavy atoms are present in the compound?

There are 10 heavy atoms present in the compound.

Does the compound have any defined atom stereocenter count?

No, the compound does not have any defined atom stereocenter count.

Is the compound canonicalized?

Yes, the compound is canonicalized.