What is the molecular formula of 4-Formyl-3-hydroxynaphthalene-2-carboxylic acid?
The molecular formula is C12H8O4.
What is the molecular weight of 4-Formyl-3-hydroxynaphthalene-2-carboxylic acid?
The molecular weight is 216.19 g/mol.
What is the IUPAC name of 4-Formyl-3-hydroxynaphthalene-2-carboxylic acid?
The IUPAC name is 4-formyl-3-hydroxynaphthalene-2-carboxylic acid.
What is the InChI of 4-Formyl-3-hydroxynaphthalene-2-carboxylic acid?
The InChI is InChI=1S/C12H8O4/c13-6-10-8-4-2-1-3-7(8)5-9(11(10)14)12(15)16/h1-6,14H,(H,15,16).
What is the InChIKey of 4-Formyl-3-hydroxynaphthalene-2-carboxylic acid?
The InChIKey is LPRBZICETYEWOZ-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Formyl-3-hydroxynaphthalene-2-carboxylic acid?
The canonical SMILES is C1=CC=C2C(=C1)C=C(C(=C2C=O)O)C(=O)O.
What is the CAS number of 4-Formyl-3-hydroxynaphthalene-2-carboxylic acid?
The CAS number is 38399-46-1.
What is the XLogP3-AA value of 4-Formyl-3-hydroxynaphthalene-2-carboxylic acid?
The XLogP3-AA value is 2.4.
How many hydrogen bond donor counts does 4-Formyl-3-hydroxynaphthalene-2-carboxylic acid have?
It has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 4-Formyl-3-hydroxynaphthalene-2-carboxylic acid have?
It has 4 hydrogen bond acceptor counts.