4-Ethylphenylboronic acid pinacol ester

• CAS: 1075719-87-7
• Catalog Number: ACM1075719877
• Category: Boronic Esters

Custom Q&A

What is the molecular formula of 4-Ethylphenylboronic acid pinacol ester?

The molecular formula is C14H21BO2.

What is the molecular weight of 4-Ethylphenylboronic acid pinacol ester?

The molecular weight is 232.13 g/mol.

What is the IUPAC name of 4-Ethylphenylboronic acid pinacol ester?

The IUPAC name is 2-(4-ethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.

What is the InChI of 4-Ethylphenylboronic acid pinacol ester?

The InChI is InChI=1S/C14H21BO2/c1-6-11-7-9-12(10-8-11)15-16-13(2,3)14(4,5)17-15/h7-10H,6H2,1-5H3.

What is the InChIKey of 4-Ethylphenylboronic acid pinacol ester?

The InChIKey is RWANCHDMVNWYHW-UHFFFAOYSA-N.

What is the canonical SMILES of 4-Ethylphenylboronic acid pinacol ester?

The canonical SMILES is B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)CC.

How many hydrogen bond donor counts does 4-Ethylphenylboronic acid pinacol ester have?

It has 0 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does 4-Ethylphenylboronic acid pinacol ester have?

It has 2 hydrogen bond acceptor counts.

How many rotatable bond counts does 4-Ethylphenylboronic acid pinacol ester have?

It has 2 rotatable bond counts.

Is 4-Ethylphenylboronic acid pinacol ester a canonicalized compound?

Yes, it is a canonicalized compound.