What is the molecular formula of 4-(Dimethylamino)-1,2,2,6,6-pentamethylpiperidine?
The molecular formula is C12H26N2.
What are the synonyms for 4-(Dimethylamino)-1,2,2,6,6-pentamethylpiperidine?
The synonyms are N,N,1,2,2,6,6-heptamethylpiperidin-4-amine and SCHEMBL2168632.
What is the molecular weight of 4-(Dimethylamino)-1,2,2,6,6-pentamethylpiperidine?
The molecular weight is 198.35 g/mol.
When was 4-(Dimethylamino)-1,2,2,6,6-pentamethylpiperidine created?
It was created on September 17, 2005.
When was 4-(Dimethylamino)-1,2,2,6,6-pentamethylpiperidine last modified?
It was last modified on October 21, 2023.
What is the IUPAC name of 4-(Dimethylamino)-1,2,2,6,6-pentamethylpiperidine?
The IUPAC name is N,N,1,2,2,6,6-heptamethylpiperidin-4-amine.
What is the InChI of 4-(Dimethylamino)-1,2,2,6,6-pentamethylpiperidine?
The InChI is InChI=1S/C12H26N2/c1-11(2)8-10(13(5)6)9-12(3,4)14(11)7/h10H,8-9H2,1-7H3.
What is the InChIKey of 4-(Dimethylamino)-1,2,2,6,6-pentamethylpiperidine?
The InChIKey is VEBFUHQIQCLTJD-UHFFFAOYSA-N.
What is the Canonical SMILES of 4-(Dimethylamino)-1,2,2,6,6-pentamethylpiperidine?
The Canonical SMILES is CC1(CC(CC(N1C)(C)C)N(C)C).
What is the CAS number of 4-(Dimethylamino)-1,2,2,6,6-pentamethylpiperidine?
The CAS number is 52185-74-7.