4-Chloroisophthalic acid

• CAS: 2845-85-4
• Catalog Number: ACM2845854
• Category: Other Products
• Molecular Weight: 200.58
• Molecular Formula: C₈H₅ClO₄
• Synonyms: 4-chloroisophthalic acid;4-Chloro-1,3-benzenedicarboxylic acid;4-Chlorobenzene-1,3-dicarboxylic acid;1,3-Benzenedicarboxylic acid, 4-chloro-;Isophthalic acid, 4-chloro-

Custom Q&A

What is the molecular formula of 4-Chloroisophthalic acid?

The molecular formula of 4-Chloroisophthalic acid is C8H5ClO4.

What are some synonyms for 4-Chloroisophthalic acid?

Some synonyms for 4-Chloroisophthalic acid include 4-chlorobenzene-1,3-dicarboxylic acid and isophthalic acid, 4-chloro.

When was 4-Chloroisophthalic acid created in PubChem?

4-Chloroisophthalic acid was created in PubChem on March 26, 2005.

What is the molecular weight of 4-Chloroisophthalic acid?

The molecular weight of 4-Chloroisophthalic acid is 200.57 g/mol.

What is the Canonical SMILES for 4-Chloroisophthalic acid?

The Canonical SMILES for 4-Chloroisophthalic acid is C1=CC(=C(C=C1C(=O)O)C(=O)O)Cl.

How many Hydrogen Bond Donors does 4-Chloroisophthalic acid have?

4-Chloroisophthalic acid has 2 Hydrogen Bond Donors.

What is the exact mass of 4-Chloroisophthalic acid?

The exact mass of 4-Chloroisophthalic acid is 199.9876363 g/mol.

How many rotatable bonds does 4-Chloroisophthalic acid have?

4-Chloroisophthalic acid has 2 rotatable bonds.

What is the topological polar surface area of 4-Chloroisophthalic acid?

The topological polar surface area of 4-Chloroisophthalic acid is 74.6 Ų.

Is 4-Chloroisophthalic acid considered a canonicalized compound in PubChem?

Yes, 4-Chloroisophthalic acid is considered a canonicalized compound in PubChem.