4-Chloro-5-ethyl-2-thiophenecarboxaldehyde

• CAS: 842135-11-9
• Catalog Number: ACM842135119
• Category: Thiophenes
• Molecular Weight: 174.64
• Molecular Formula: C7H7ClOS
• Synonyms: 2-Thiophenecarboxaldehyde, 4-chloro-5-ethyl-

Custom Q&A

What is the molecular formula of 4-Chloro-5-ethyl-2-thiophenecarboxaldehyde?

The molecular formula is C7H7ClOS.

What is the molecular weight of 4-Chloro-5-ethyl-2-thiophenecarboxaldehyde?

The molecular weight is 174.65 g/mol.

What is the IUPAC name of 4-Chloro-5-ethyl-2-thiophenecarboxaldehyde?

The IUPAC name is 4-chloro-5-ethylthiophene-2-carbaldehyde.

What is the InChI of 4-Chloro-5-ethyl-2-thiophenecarboxaldehyde?

The InChI is InChI=1S/C7H7ClOS/c1-2-7-6(8)3-5(4-9)10-7/h3-4H,2H2,1H3.

What is the InChIKey of 4-Chloro-5-ethyl-2-thiophenecarboxaldehyde?

The InChIKey is WRTSHXGKSBKPID-UHFFFAOYSA-N.

What is the canonical SMILES of 4-Chloro-5-ethyl-2-thiophenecarboxaldehyde?

The canonical SMILES is CCC1=C(C=C(S1)C=O)Cl.

What is the XLogP3-AA value of 4-Chloro-5-ethyl-2-thiophenecarboxaldehyde?

The XLogP3-AA value is 2.9.

How many hydrogen bond donor atoms are there in 4-Chloro-5-ethyl-2-thiophenecarboxaldehyde?

There are 0 hydrogen bond donor atoms.

How many hydrogen bond acceptor atoms are there in 4-Chloro-5-ethyl-2-thiophenecarboxaldehyde?

There are 2 hydrogen bond acceptor atoms.

How many rotatable bonds are there in 4-Chloro-5-ethyl-2-thiophenecarboxaldehyde?

There are 2 rotatable bonds.