CAS
166386-48-7 Purity
98%
166386-48-7 Purity
98%
Inquiry Basket
4-Chloro-3-fluoro-2-formylphenylboronic acid
CAS
1451392-90-7
Catalog Number
ACM1451392907
Category
Boronic Acids
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 4-Chloro-3-fluoro-2-formylphenylboronic acid?
The molecular formula of 4-Chloro-3-fluoro-2-formylphenylboronic acid is C7H5BClFO3.
When was 4-Chloro-3-fluoro-2-formylphenylboronic acid created?
It was created on August 8, 2012.
What is the IUPAC name of 4-Chloro-3-fluoro-2-formylphenylboronic acid?
The IUPAC name of 4-Chloro-3-fluoro-2-formylphenylboronic acid is (4-chloro-3-fluoro-2-formylphenyl)boronic acid.
What is the InChI of 4-Chloro-3-fluoro-2-formylphenylboronic acid?
The InChI of 4-Chloro-3-fluoro-2-formylphenylboronic acid is InChI=1S/C7H5BClFO3/c9-6-2-1-5(8(12)13)4(3-11)7(6)10/h1-3,12-13H.
What is the InChIKey of 4-Chloro-3-fluoro-2-formylphenylboronic acid?
The InChIKey of 4-Chloro-3-fluoro-2-formylphenylboronic acid is GQLWOYMNRUQGID-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Chloro-3-fluoro-2-formylphenylboronic acid?
The canonical SMILES of 4-Chloro-3-fluoro-2-formylphenylboronic acid is B(C1=C(C(=C(C=C1)Cl)F)C=O)(O)O.
What is the molecular weight of 4-Chloro-3-fluoro-2-formylphenylboronic acid?
The molecular weight of 4-Chloro-3-fluoro-2-formylphenylboronic acid is 202.38 g/mol.
How many hydrogen bond donor counts does 4-Chloro-3-fluoro-2-formylphenylboronic acid have?
4-Chloro-3-fluoro-2-formylphenylboronic acid has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 4-Chloro-3-fluoro-2-formylphenylboronic acid have?
4-Chloro-3-fluoro-2-formylphenylboronic acid has 4 hydrogen bond acceptor counts.
How many rotatable bond counts does 4-Chloro-3-fluoro-2-formylphenylboronic acid have?
4-Chloro-3-fluoro-2-formylphenylboronic acid has 2 rotatable bond counts.
Recommended Products
