CAS
--- Purity
---
--- Purity
---
Shopping basket
4-Butylcyclohexanecarboxylic acid
Catalog Number
ACMA00000544
Category
Alkanes
Molecular Weight
184.28
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Hazard Statements
H302
RIDADR
NONH for all modes of transport
Symbol
GHS07
What is the molecular formula of 4-Butylcyclohexanecarboxylic acid?
The molecular formula of 4-Butylcyclohexanecarboxylic acid is C11H20O2.
What is the molecular weight of 4-Butylcyclohexanecarboxylic acid?
The molecular weight of 4-Butylcyclohexanecarboxylic acid is 184.27 g/mol.
What is the IUPAC name of 4-Butylcyclohexanecarboxylic acid?
The IUPAC name of 4-Butylcyclohexanecarboxylic acid is 4-butylcyclohexane-1-carboxylic acid.
What is the InChI of 4-Butylcyclohexanecarboxylic acid?
The InChI of 4-Butylcyclohexanecarboxylic acid is InChI=1S/C11H20O2/c1-2-3-4-9-5-7-10(8-6-9)11(12)13/h9-10H,2-8H2,1H3,(H,12,13).
What is the InChIKey of 4-Butylcyclohexanecarboxylic acid?
The InChIKey of 4-Butylcyclohexanecarboxylic acid is BALGERHMIXFENA-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Butylcyclohexanecarboxylic acid?
The canonical SMILES of 4-Butylcyclohexanecarboxylic acid is CCCCC1CCC(CC1)C(=O)O.
What is the CAS number of 4-Butylcyclohexanecarboxylic acid?
The CAS number of 4-Butylcyclohexanecarboxylic acid is 38289-28-0.
What is the EC number of 4-Butylcyclohexanecarboxylic acid?
The EC number of 4-Butylcyclohexanecarboxylic acid is 677-973-9.
What is the XLogP3-AA value of 4-Butylcyclohexanecarboxylic acid?
The XLogP3-AA value of 4-Butylcyclohexanecarboxylic acid is 3.7.
What is the topological polar surface area of 4-Butylcyclohexanecarboxylic acid?
The topological polar surface area of 4-Butylcyclohexanecarboxylic acid is 37.3Ų.
Recommended Products
