4-Butoxy-N-hydroxy-3-methoxy-benzamide

• Catalog Number: ACMA00002228
• Category: Ethers
• Molecular Weight: 239.27
• Molecular Formula: C₁₂H₁₇NO₂
• Hazard Statements: H319
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of 4-Butoxy-N-hydroxy-3-methoxy-benzamide?

The molecular formula is C12H17NO4.

What is the molecular weight of 4-Butoxy-N-hydroxy-3-methoxy-benzamide?

The molecular weight is 239.27 g/mol.

What is the IUPAC name of 4-Butoxy-N-hydroxy-3-methoxy-benzamide?

The IUPAC name is 4-butoxy-N-hydroxy-3-methoxybenzamide.

What is the InChI of 4-Butoxy-N-hydroxy-3-methoxy-benzamide?

The InChI is InChI=1S/C12H17NO4/c1-3-4-7-17-10-6-5-9(12(14)13-15)8-11(10)16-2/h5-6,8,15H,3-4,7H2,1-2H3,(H,13,14).

What is the InChIKey of 4-Butoxy-N-hydroxy-3-methoxy-benzamide?

The InChIKey is UTOLMUUYIQFHDG-UHFFFAOYSA-N.

What is the canonical SMILES of 4-Butoxy-N-hydroxy-3-methoxy-benzamide?

The canonical SMILES is CCCCOC1=C(C=C(C=C1)C(=O)NO)OC.

What is the XLogP3 value of 4-Butoxy-N-hydroxy-3-methoxy-benzamide?

The XLogP3 value is 2.1.

How many hydrogen bond donor counts does 4-Butoxy-N-hydroxy-3-methoxy-benzamide have?

It has 2 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does 4-Butoxy-N-hydroxy-3-methoxy-benzamide have?

It has 4 hydrogen bond acceptor counts.

What is the topological polar surface area of 4-Butoxy-N-hydroxy-3-methoxy-benzamide?

The topological polar surface area is 67.8Ų.