4-Bromopyridine-2-carboxylic acid ethyl ester

CAS

62150-47-4

Catalog Number

ACM62150474

Category

Bromine Series

Molecular Weight

230.06

Molecular Formula

C8H8BrNO2

MSDS COA Spec Sheet

If you have any other questions or need other size, please get a quote.

Specification

Synonyms

4-Bromo-pyridine-2-carboxylic acid ethyl ester;Ethyl 4-bromopyridine-2-carboxylate

What is the molecular formula of 4-Bromopyridine-2-carboxylic acid ethyl ester?

The molecular formula of 4-Bromopyridine-2-carboxylic acid ethyl ester is C8H8BrNO2.

What are the synonyms for 4-Bromopyridine-2-carboxylic acid ethyl ester?

The synonyms for 4-Bromopyridine-2-carboxylic acid ethyl ester are Ethyl 4-bromopicolinate, Ethyl 4-bromopyridine-2-carboxylate, and 4-Bromo-pyridine-2-carboxylic acid ethyl ester.

What is the molecular weight of 4-Bromopyridine-2-carboxylic acid ethyl ester?

The molecular weight of 4-Bromopyridine-2-carboxylic acid ethyl ester is 230.06 g/mol.

When was 4-Bromopyridine-2-carboxylic acid ethyl ester created?

4-Bromopyridine-2-carboxylic acid ethyl ester was created on September 1, 2009.

When was 4-Bromopyridine-2-carboxylic acid ethyl ester last modified?

4-Bromopyridine-2-carboxylic acid ethyl ester was last modified on December 2, 2023.

What is the IUPAC name of 4-Bromopyridine-2-carboxylic acid ethyl ester?

The IUPAC name of 4-Bromopyridine-2-carboxylic acid ethyl ester is ethyl 4-bromopyridine-2-carboxylate.

What is the InChI of 4-Bromopyridine-2-carboxylic acid ethyl ester?

The InChI of 4-Bromopyridine-2-carboxylic acid ethyl ester is InChI=1S/C8H8BrNO2/c1-2-12-8(11)7-5-6(9)3-4-10-7/h3-5H,2H2,1H3.

What is the InChIKey of 4-Bromopyridine-2-carboxylic acid ethyl ester?

The InChIKey of 4-Bromopyridine-2-carboxylic acid ethyl ester is ATVHAWNFNGFPEM-UHFFFAOYSA-N.

What is the canonical SMILES of 4-Bromopyridine-2-carboxylic acid ethyl ester?

The canonical SMILES of 4-Bromopyridine-2-carboxylic acid ethyl ester is CCOC(=O)C1=NC=CC(=C1)Br.

What is the CAS number of 4-Bromopyridine-2-carboxylic acid ethyl ester?

The CAS number of 4-Bromopyridine-2-carboxylic acid ethyl ester is 62150-47-4.