(4-Bromophenyl)(cyclopropyl)methanone

• CAS: 6952-89-2
• Catalog Number: ACM6952892
• Category: Bromine Series
• Molecular Weight: 225.08
• Molecular Formula: C₁₀H₉OBr

Custom Q&A

What is the molecular formula of (4-Bromophenyl)(cyclopropyl)methanone?

The molecular formula is C10H9BrO.

What is the molecular weight of (4-Bromophenyl)(cyclopropyl)methanone?

The molecular weight is 225.08 g/mol.

What is the IUPAC name of (4-Bromophenyl)(cyclopropyl)methanone?

The IUPAC name is (4-bromophenyl)-cyclopropylmethanone.

What is the InChI of (4-Bromophenyl)(cyclopropyl)methanone?

The InChI is InChI=1S/C10H9BrO/c11-9-5-3-8(4-6-9)10(12)7-1-2-7/h3-7H,1-2H2.

What is the InChIKey of (4-Bromophenyl)(cyclopropyl)methanone?

The InChIKey is QTHHOINSCNBYQO-UHFFFAOYSA-N.

What is the canonical SMILES of (4-Bromophenyl)(cyclopropyl)methanone?

The canonical SMILES is C1CC1C(=O)C2=CC=C(C=C2)Br.

What is the CAS number of (4-Bromophenyl)(cyclopropyl)methanone?

The CAS number is 6952-89-2.

What is the European Community (EC) number of (4-Bromophenyl)(cyclopropyl)methanone?

The European Community (EC) number is 230-130-5.

What is the DSSTox Substance ID of (4-Bromophenyl)(cyclopropyl)methanone?

The DSSTox Substance ID is DTXSID80219774.

Is (4-Bromophenyl)(cyclopropyl)methanone a canonicalized compound?

Yes, it is a canonicalized compound.