4-Bromo-6-hydroxyisoindolin-1-one

• CAS: 808127-76-6
• Catalog Number: ACM808127766
• Category: Bromine Series

Custom Q&A

What is the molecular formula of 4-Bromo-6-hydroxyisoindolin-1-one?

The molecular formula is C8H6BrNO2.

What is the molecular weight of 4-Bromo-6-hydroxyisoindolin-1-one?

The molecular weight is 228.04 g/mol.

What is the IUPAC name of 4-Bromo-6-hydroxyisoindolin-1-one?

The IUPAC name is 4-bromo-6-hydroxy-2,3-dihydroisoindol-1-one.

What is the InChI of 4-Bromo-6-hydroxyisoindolin-1-one?

The InChI is InChI=1S/C8H6BrNO2/c9-7-2-4(11)1-5-6(7)3-10-8(5)12/h1-2,11H,3H2,(H,10,12).

What is the InChIKey of 4-Bromo-6-hydroxyisoindolin-1-one?

The InChIKey is BQPRSUFYMWPKEI-UHFFFAOYSA-N.

What is the canonical SMILES of 4-Bromo-6-hydroxyisoindolin-1-one?

The canonical SMILES is C1C2=C(C=C(C=C2Br)O)C(=O)N1.

What is the CAS number of 4-Bromo-6-hydroxyisoindolin-1-one?

The CAS number is 808127-76-6.

What is the European Community (EC) number of 4-Bromo-6-hydroxyisoindolin-1-one?

The European Community (EC) number is 806-915-9.

What is the DSSTox Substance ID of 4-Bromo-6-hydroxyisoindolin-1-one?

The DSSTox Substance ID is DTXSID50619883.

Is 4-Bromo-6-hydroxyisoindolin-1-one a canonicalized compound?

Yes, it is a canonicalized compound.