4-Bromo-3-methylthiophenecarboxylic acid

• CAS: 265652-39-9
• Catalog Number: ACM265652399
• Category: Bromine Series
• Molecular Weight: 221.07
• Molecular Formula: C₆H₅BrO₂S
• Synonyms: 4-BROMO-3-METHYLTHIOPHENECARBOXYLIC ACID

Custom Q&A

What is the molecular formula of 4-Bromo-3-methylthiophenecarboxylic acid?

The molecular formula is C6H5BrO2S.

What is the molecular weight of 4-Bromo-3-methylthiophenecarboxylic acid?

The molecular weight is 221.07 g/mol.

What is the IUPAC name of 4-Bromo-3-methylthiophenecarboxylic acid?

The IUPAC name is 4-bromo-3-methylthiophene-2-carboxylic acid.

What is the InChI code of 4-Bromo-3-methylthiophenecarboxylic acid?

The InChI code is InChI=1S/C6H5BrO2S/c1-3-4(7)2-10-5(3)6(8)9/h2H,1H3,(H,8,9).

What is the InChIKey of 4-Bromo-3-methylthiophenecarboxylic acid?

The InChIKey is TUVDPNVBUMLEHW-UHFFFAOYSA-N.

What is the Canonical SMILES of 4-Bromo-3-methylthiophenecarboxylic acid?

The Canonical SMILES is CC1=C(SC=C1Br)C(=O)O.

What is the CAS number of 4-Bromo-3-methylthiophenecarboxylic acid?

The CAS number is 265652-39-9.

What is the XLogP3-AA value of 4-Bromo-3-methylthiophenecarboxylic acid?

The XLogP3-AA value is 2.5.

What is the hydrogen bond donor count of 4-Bromo-3-methylthiophenecarboxylic acid?

The hydrogen bond donor count is 1.

What is the hydrogen bond acceptor count of 4-Bromo-3-methylthiophenecarboxylic acid?

The hydrogen bond acceptor count is 3.