4-Bromo-3,5-dimethylanisole

• CAS: 6267-34-1
• Catalog Number: ACM6267341
• Category: Bromine Series
• Molecular Weight: 215.09
• Molecular Formula: C9H11BrO

Custom Q&A

What is the molecular formula of 4-Bromo-3,5-dimethylanisole?

The molecular formula of 4-Bromo-3,5-dimethylanisole is C9H11BrO.

What is the molecular weight of 4-Bromo-3,5-dimethylanisole?

The molecular weight of 4-Bromo-3,5-dimethylanisole is 215.09 g/mol.

What is the IUPAC name of 4-Bromo-3,5-dimethylanisole?

The IUPAC name of 4-Bromo-3,5-dimethylanisole is 2-bromo-5-methoxy-1,3-dimethylbenzene.

What is the InChI of 4-Bromo-3,5-dimethylanisole?

The InChI of 4-Bromo-3,5-dimethylanisole is InChI=1S/C9H11BrO/c1-6-4-8(11-3)5-7(2)9(6)10/h4-5H,1-3H3.

What is the InChIKey of 4-Bromo-3,5-dimethylanisole?

The InChIKey of 4-Bromo-3,5-dimethylanisole is RAWZVIWEDAGMPW-UHFFFAOYSA-N.

What is the canonical SMILES of 4-Bromo-3,5-dimethylanisole?

The canonical SMILES of 4-Bromo-3,5-dimethylanisole is CC1=CC(=CC(=C1Br)C)OC.

What is the CAS number of 4-Bromo-3,5-dimethylanisole?

The CAS number of 4-Bromo-3,5-dimethylanisole is 6267-34-1.

What is the XLogP3-AA value of 4-Bromo-3,5-dimethylanisole?

The XLogP3-AA value of 4-Bromo-3,5-dimethylanisole is 3.3.

How many hydrogen bond donor counts does 4-Bromo-3,5-dimethylanisole have?

4-Bromo-3,5-dimethylanisole has 0 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does 4-Bromo-3,5-dimethylanisole have?

4-Bromo-3,5-dimethylanisole has 1 hydrogen bond acceptor count.