4-Bromo-2-nitrobenzoic acid

• CAS: 99277-71-1
• Catalog Number: ACM99277711
• Category: Bromine Series
• Molecular Weight: 246.01
• Molecular Formula: C₇H₄BrNO₄

Custom Q&A

What is the molecular formula of 4-Bromo-2-nitrobenzoic acid?

The molecular formula of 4-Bromo-2-nitrobenzoic acid is C7H4BrNO4.

What is the molecular weight of 4-Bromo-2-nitrobenzoic acid?

The molecular weight of 4-Bromo-2-nitrobenzoic acid is 246.01 g/mol.

What is the IUPAC name of 4-Bromo-2-nitrobenzoic acid?

The IUPAC name of 4-Bromo-2-nitrobenzoic acid is 4-bromo-2-nitrobenzoic acid.

What is the InChI key of 4-Bromo-2-nitrobenzoic acid?

The InChI key of 4-Bromo-2-nitrobenzoic acid is ZIRHHEZLJGORGU-UHFFFAOYSA-N.

What is the canonical SMILES of 4-Bromo-2-nitrobenzoic acid?

The canonical SMILES of 4-Bromo-2-nitrobenzoic acid is C1=CC(=C(C=C1Br)[N+](=O)[O-])C(=O)O.

What is the CAS number of 4-Bromo-2-nitrobenzoic acid?

The CAS number of 4-Bromo-2-nitrobenzoic acid is 99277-71-1.

What is the EC number of 4-Bromo-2-nitrobenzoic acid?

The EC number of 4-Bromo-2-nitrobenzoic acid is 627-797-3.

What is the DSSTox Substance ID of 4-Bromo-2-nitrobenzoic acid?

The DSSTox Substance ID of 4-Bromo-2-nitrobenzoic acid is DTXSID20396250.

Is 4-Bromo-2-nitrobenzoic acid canonicalized?

Yes, 4-Bromo-2-nitrobenzoic acid is canonicalized.