What is the molecular formula of 4-Bromo-2-ethylbenzenesulfonyl chloride?
The molecular formula is C8H8BrClO2S.
What is the molecular weight of 4-Bromo-2-ethylbenzenesulfonyl chloride?
The molecular weight is 283.57 g/mol.
What is the IUPAC name of 4-Bromo-2-ethylbenzenesulfonyl chloride?
The IUPAC name is 4-bromo-2-ethylbenzenesulfonyl chloride.
What is the CAS number of 4-Bromo-2-ethylbenzenesulfonyl chloride?
The CAS number is 175278-24-7.
What is the InChI of 4-Bromo-2-ethylbenzenesulfonyl chloride?
The InChI is InChI=1S/C8H8BrClO2S/c1-2-6-5-7(9)3-4-8(6)13(10,11)12/h3-5H,2H2,1H3.
What is the InChIKey of 4-Bromo-2-ethylbenzenesulfonyl chloride?
The InChIKey is UOIVESXBURLTPX-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Bromo-2-ethylbenzenesulfonyl chloride?
The canonical SMILES is CCC1=C(C=CC(=C1)Br)S(=O)(=O)Cl.
What is the XLogP3-AA of 4-Bromo-2-ethylbenzenesulfonyl chloride?
The XLogP3-AA is 3.4.
How many hydrogen bond donor counts are there in 4-Bromo-2-ethylbenzenesulfonyl chloride?
There are 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts are there in 4-Bromo-2-ethylbenzenesulfonyl chloride?
There are 2 hydrogen bond acceptor counts.