What is the molecular formula of 4-Bromo-2-chlorobenzenesulfonyl chloride?
The molecular formula is C6H3BrCl2O2S.
What is the molecular weight of 4-Bromo-2-chlorobenzenesulfonyl chloride?
The molecular weight is 289.96 g/mol.
What is the IUPAC name of 4-Bromo-2-chlorobenzenesulfonyl chloride?
The IUPAC name is 4-bromo-2-chlorobenzenesulfonyl chloride.
What is the InChI of 4-Bromo-2-chlorobenzenesulfonyl chloride?
The InChI is InChI=1S/C6H3BrCl2O2S/c7-4-1-2-6(5(8)3-4)12(9,10)11/h1-3H.
What is the InChIKey of 4-Bromo-2-chlorobenzenesulfonyl chloride?
The InChIKey is OECYEHWJPRPCOH-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Bromo-2-chlorobenzenesulfonyl chloride?
The canonical SMILES is C1=CC(=C(C=C1Br)Cl)S(=O)(=O)Cl.
What is the CAS number of 4-Bromo-2-chlorobenzenesulfonyl chloride?
The CAS number is 351003-52-6.
What is the European Community (EC) number of 4-Bromo-2-chlorobenzenesulfonyl chloride?
The EC number is 626-264-2.
What is the DSSTox Substance ID of 4-Bromo-2-chlorobenzenesulfonyl chloride?
The DSSTox Substance ID is DTXSID40370491.
Is 4-Bromo-2-chlorobenzenesulfonyl chloride a canonicalized compound?
Yes, it is a canonicalized compound according to PubChem.