4-Bromo-1-chloro-2-(chloromethyl)benzene

• CAS: 928758-19-4
• Catalog Number: ACM928758194
• Category: Bromine Series

Custom Q&A

What is the molecular formula of 4-Bromo-1-chloro-2-(chloromethyl)benzene?

The molecular formula is C7H5BrCl2.

What is the molecular weight of 4-Bromo-1-chloro-2-(chloromethyl)benzene?

The molecular weight is 239.92 g/mol.

What is the IUPAC name of 4-Bromo-1-chloro-2-(chloromethyl)benzene?

The IUPAC name is 4-bromo-1-chloro-2-(chloromethyl)benzene.

What is the InChI of 4-Bromo-1-chloro-2-(chloromethyl)benzene?

The InChI is InChI=1S/C7H5BrCl2/c8-6-1-2-7(10)5(3-6)4-9/h1-3H,4H2.

What is the InChIKey of 4-Bromo-1-chloro-2-(chloromethyl)benzene?

The InChIKey is XEFCTCLLJDRHSB-UHFFFAOYSA-N.

What is the canonical SMILES of 4-Bromo-1-chloro-2-(chloromethyl)benzene?

The canonical SMILES is C1=CC(=C(C=C1Br)CCl)Cl.

What is the CAS number of 4-Bromo-1-chloro-2-(chloromethyl)benzene?

The CAS number is 928758-19-4.

What is the XLogP3-AA value of 4-Bromo-1-chloro-2-(chloromethyl)benzene?

The XLogP3-AA value is 3.6.

What is the hydrogen bond donor count of 4-Bromo-1-chloro-2-(chloromethyl)benzene?

The hydrogen bond donor count is 0.

Is 4-Bromo-1-chloro-2-(chloromethyl)benzene a canonicalized compound?

Yes, it is a canonicalized compound.