4-(Boc-methylamino)phenylboronic acid pinacol ester

• CAS: 916587-44-5
• Catalog Number: ACM916587445-1
• Category: Other

Custom Q&A

What is the molecular formula of the compound?

The molecular formula of the compound is C18H28BNO4.

What is the molecular weight of the compound?

The molecular weight of the compound is 333.2 g/mol.

What is the IUPAC name of the compound?

The IUPAC name of the compound is tert-butyl N-methyl-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C18H28BNO4/c1-16(2,3)22-15(21)20(8)14-11-9-13(10-12-14)19-23-17(4,5)18(6,7)24-19/h9-12H,1-8H3.

What is the InChIKey of the compound?

The InChIKey of the compound is MWNMXMKLILKYOS-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES of the compound is B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)N(C)C(=O)OC(C)(C)C.

What is the CAS number of the compound?

The CAS number of the compound is 916587-44-5.

What is the EC number of the compound?

The EC number of the compound is 671-696-7.

What is the DSSTox Substance ID of the compound?

The DSSTox Substance ID of the compound is DTXSID60405739.

Is the compound canonicalized?

Yes, the compound is canonicalized.