4-Benzyloxy-2-(trifluoromethyl)benzaldehyde

• Catalog Number: ACMA00002546
• Category: Ethers
• Molecular Weight: 280.24
• Molecular Formula: C₂₁H₂₆O₃
• Hazard Statements: H410
• RIDADR: NONH for all modes of transport
• Symbol: GHS09

Custom Q&A

What is the molecular formula of the compound?

The molecular formula is C15H11F3O2.

What is the molecular weight of the compound?

The molecular weight is 280.24 g/mol.

What is the IUPAC name of the compound?

The IUPAC name is 4-phenylmethoxy-2-(trifluoromethyl)benzaldehyde.

What is the InChI of the compound?

The InChI is InChI=1S/C15H11F3O2/c16-15(17,18)14-8-13(7-6-12(14)9-19)20-10-11-4-2-1-3-5-11/h1-9H,10H2.

What is the InChIKey of the compound?

The InChIKey is LRTMKGSVSNXZSP-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES is C1=CC=C(C=C1)COC2=CC(=C(C=C2)C=O)C(F)(F)F.

What is the XLogP3-AA value of the compound?

The XLogP3-AA value is 3.7.

How many hydrogen bond donor count does the compound have?

The compound has 0 hydrogen bond donor count.

How many hydrogen bond acceptor count does the compound have?

The compound has 5 hydrogen bond acceptor count.

How many rotatable bond count does the compound have?

The compound has 4 rotatable bond count.