4-(Benzyloxy)-2-hydroxybenzaldehyde

• Catalog Number: ACMA00002454
• Category: Ethers
• Molecular Weight: 228.24
• Molecular Formula: C₁₄H₁₁NOS
• Hazard Statements: H317-H318
• RIDADR: NONH for all modes of transport
• Symbol: GHS05

Custom Q&A

What is the molecular formula of 4-(Benzyloxy)-2-hydroxybenzaldehyde?

The molecular formula of 4-(Benzyloxy)-2-hydroxybenzaldehyde is C14H12O3.

What is the CAS number of 4-(Benzyloxy)-2-hydroxybenzaldehyde?

The CAS number of 4-(Benzyloxy)-2-hydroxybenzaldehyde is 52085-14-0.

What is the IUPAC name of 4-(Benzyloxy)-2-hydroxybenzaldehyde?

The IUPAC name of 4-(Benzyloxy)-2-hydroxybenzaldehyde is 2-hydroxy-4-phenylmethoxybenzaldehyde.

What is the molecular weight of 4-(Benzyloxy)-2-hydroxybenzaldehyde?

The molecular weight of 4-(Benzyloxy)-2-hydroxybenzaldehyde is 228.24 g/mol.

What is the InChI of 4-(Benzyloxy)-2-hydroxybenzaldehyde?

The InChI of 4-(Benzyloxy)-2-hydroxybenzaldehyde is InChI=1S/C14H12O3/c15-9-12-6-7-13(8-14(12)16)17-10-11-4-2-1-3-5-11/h1-9,16H,10H2.

How many hydrogen bond donor counts does 4-(Benzyloxy)-2-hydroxybenzaldehyde have?

4-(Benzyloxy)-2-hydroxybenzaldehyde has 1 hydrogen bond donor count.

How many hydrogen bond acceptor counts does 4-(Benzyloxy)-2-hydroxybenzaldehyde have?

4-(Benzyloxy)-2-hydroxybenzaldehyde has 3 hydrogen bond acceptor counts.

How many rotatable bond counts does 4-(Benzyloxy)-2-hydroxybenzaldehyde have?

4-(Benzyloxy)-2-hydroxybenzaldehyde has 4 rotatable bond counts.

What is the exact mass of 4-(Benzyloxy)-2-hydroxybenzaldehyde?

The exact mass of 4-(Benzyloxy)-2-hydroxybenzaldehyde is 228.078644241 g/mol.

Is 4-(Benzyloxy)-2-hydroxybenzaldehyde a canonicalized compound?

Yes, 4-(Benzyloxy)-2-hydroxybenzaldehyde is a canonicalized compound.