CAS
213382-41-3 Purity
---
213382-41-3 Purity
---
Inquiry Basket
4-Amino-3-bromo-2-chloropyridine
CAS
215364-85-5
Catalog Number
ACM215364855-1
Category
Bromine Series
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 4-Amino-3-bromo-2-chloropyridine?
The molecular formula of 4-Amino-3-bromo-2-chloropyridine is C5H4BrClN2.
What is the molecular weight of 4-Amino-3-bromo-2-chloropyridine?
The molecular weight of 4-Amino-3-bromo-2-chloropyridine is 207.45 g/mol.
What is the IUPAC name of 4-Amino-3-bromo-2-chloropyridine?
The IUPAC name of 4-Amino-3-bromo-2-chloropyridine is 3-bromo-2-chloropyridin-4-amine.
What is the InChI of 4-Amino-3-bromo-2-chloropyridine?
The InChI of 4-Amino-3-bromo-2-chloropyridine is InChI=1S/C5H4BrClN2/c6-4-3(8)1-2-9-5(4)7/h1-2H,(H2,8,9).
What is the InChIKey of 4-Amino-3-bromo-2-chloropyridine?
The InChIKey of 4-Amino-3-bromo-2-chloropyridine is KTWAUKYSQFZIET-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Amino-3-bromo-2-chloropyridine?
The canonical SMILES of 4-Amino-3-bromo-2-chloropyridine is C1=CN=C(C(=C1N)Br)Cl.
What is the CAS number of 4-Amino-3-bromo-2-chloropyridine?
The CAS number of 4-Amino-3-bromo-2-chloropyridine is 215364-85-5.
How many hydrogen bond donor counts does 4-Amino-3-bromo-2-chloropyridine have?
4-Amino-3-bromo-2-chloropyridine has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does 4-Amino-3-bromo-2-chloropyridine have?
4-Amino-3-bromo-2-chloropyridine has 2 hydrogen bond acceptor counts.
Recommended Products
