4-Amino-2-phenylphenol

• CAS: 19434-42-5
• Catalog Number: ACM19434425
• Category: Main Products
• Molecular Weight: 185.2
• Molecular Formula: C₁₂H₁₁NO

Custom Q&A

What is the molecular formula of 4-Amino-2-phenylphenol?

The molecular formula is C12H11NO.

What is the molecular weight of 4-Amino-2-phenylphenol?

The molecular weight is 185.22 g/mol.

What is the IUPAC name of 4-Amino-2-phenylphenol?

The IUPAC name is 4-amino-2-phenylphenol.

What is the InChI of 4-Amino-2-phenylphenol?

The InChI is InChI=1S/C12H11NO/c13-10-6-7-12(14)11(8-10)9-4-2-1-3-5-9/h1-8,14H,13H2.

What is the InChIKey of 4-Amino-2-phenylphenol?

The InChIKey is OUIITAOCYATDMY-UHFFFAOYSA-N.

What is the canonical SMILES of 4-Amino-2-phenylphenol?

The canonical SMILES is C1=CC=C(C=C1)C2=C(C=CC(=C2)N)O.

What is the CAS number of 4-Amino-2-phenylphenol?

The CAS number is 19434-42-5.

What is the European Community (EC) number of 4-Amino-2-phenylphenol?

The EC number is 827-413-6.

What is the DSSTox Substance ID of 4-Amino-2-phenylphenol?

The DSSTox Substance ID is DTXSID70173058.

What is the XLogP3 value of 4-Amino-2-phenylphenol?

The XLogP3 value is 2.9.